CAS 1009628-70-9 is the registry number for Sodium 2-(trifluoromethyl)benzene-1-sulfinate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Sodium 2-(trifluoromethyl)benzenesulfinate (CAS 1009628-70-9) is a chemical compound with the molecular formula C7H4F3NaO2S and a molecular weight of 232.16 g/mol. IUPAC name: sodium 2-(trifluoromethyl)benzenesulfinate. InChIKey: XYBCDQSEZJACQL-UHFFFAOYSA-M.
| Molecular formula | C7H4F3NaO2S |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | sodium 2-(trifluoromethyl)benzenesulfinate |
| InChIKey | XYBCDQSEZJACQL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)