CAS 118849-61-9 appears in our catalog under these names: Sodium 3–(trifluoromethyl)benzene–1–sulfinate, 3-(Trifluoromethyl)benzenesulfinic acid sodium. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 10g, 1g, 2,5g, 250mg, 500mg, 5g.
Sodium 3-(trifluoromethyl)benzenesulfinate (CAS 118849-61-9) is a chemical compound with the molecular formula C7H4F3NaO2S and a molecular weight of 232.16 g/mol. IUPAC name: sodium 3-(trifluoromethyl)benzenesulfinate. InChIKey: LPUWNZIPTPFGDE-UHFFFAOYSA-M.
| Molecular formula | C7H4F3NaO2S |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | sodium 3-(trifluoromethyl)benzenesulfinate |
| InChIKey | LPUWNZIPTPFGDE-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)S(=O)[O-])C(F)(F)F.[Na+] |
Computed by PubChem (NCBI)