CAS 89520-63-8 appears in our catalog under these names: Sodium 4-(trifluoromethyl)benzene-1-sulfinate, 4-(Trifluoromethyl)benzenesulfinic acid sodium salt, 95%, 95%, 4-(Trifluoromethyl)benzenesulfinic acid sodium salt, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
Sodium 4-(trifluoromethyl)benzenesulfinate (CAS 89520-63-8) is a chemical compound with the molecular formula C7H4F3NaO2S and a molecular weight of 232.16 g/mol. IUPAC name: sodium 4-(trifluoromethyl)benzenesulfinate. InChIKey: IRJVONHUBTUTAL-UHFFFAOYSA-M.
| Molecular formula | C7H4F3NaO2S |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | sodium 4-(trifluoromethyl)benzenesulfinate |
| InChIKey | IRJVONHUBTUTAL-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(F)(F)F)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)