CAS 100965-49-9 is the registry number for 6,8-Dichloro-2-phenyl-3,4-dihydro-2H-1-benzopyran-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6,8-dichloro-2-phenyl-2,3-dihydrochromen-4-one (CAS 100965-49-9) is a chemical compound with the molecular formula C15H10Cl2O2 and a molecular weight of 293.1 g/mol. IUPAC name: 6,8-dichloro-2-phenyl-2,3-dihydrochromen-4-one. InChIKey: NNKQWSGEMHEAQT-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2O2 |
|---|---|
| Molecular weight | 293.1 g/mol |
| IUPAC name | 6,8-dichloro-2-phenyl-2,3-dihydrochromen-4-one |
| InChIKey | NNKQWSGEMHEAQT-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C1=O)C=C(C=C2Cl)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)