CAS 6297-12-7 appears in our catalog under these names: 1,3-Bis(3-chlorophenyl)propane-1,3-dione, 98%, 1,3-Bis(3-chlorophenyl)propane-1,3-dione, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
1,3-bis(3-chlorophenyl)propane-1,3-dione (CAS 6297-12-7) is a chemical compound with the molecular formula C15H10Cl2O2 and a molecular weight of 293.1 g/mol. IUPAC name: 1,3-bis(3-chlorophenyl)propane-1,3-dione. InChIKey: MGMNGNDIJHTGOF-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2O2 |
|---|---|
| Molecular weight | 293.1 g/mol |
| IUPAC name | 1,3-bis(3-chlorophenyl)propane-1,3-dione |
| InChIKey | MGMNGNDIJHTGOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)CC(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)