CAS 1096942-33-4 is the registry number for 5-(2,5-Dichlorobenzoyl)-2,3-dihydro-1-benzofuran. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone (CAS 1096942-33-4) is a chemical compound with the molecular formula C15H10Cl2O2 and a molecular weight of 293.1 g/mol. IUPAC name: (2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone. InChIKey: WWNMPQMGUGAXFS-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2O2 |
|---|---|
| Molecular weight | 293.1 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone |
| InChIKey | WWNMPQMGUGAXFS-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C(=O)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)