CAS 1009734-33-1 appears in our catalog under these names: HZ–1157, 5-tert-Butoxyquinazoline-2,4-diamine, 95%, HZ-1157/ 98.23% (existing batch purity), HZ-1157, 5-tert-butoxyquinazoline-2,4-diaMine. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso).
5-[(2-methylpropan-2-yl)oxy]quinazoline-2,4-diamine (CAS 1009734-33-1) is a chemical compound with the molecular formula C12H16N4O and a molecular weight of 232.28 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxy]quinazoline-2,4-diamine. InChIKey: JQHKDYFLRJIBLX-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxy]quinazoline-2,4-diamine |
| InChIKey | JQHKDYFLRJIBLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC=CC2=C1C(=NC(=N2)N)N |
Computed by PubChem (NCBI)