CAS 887202-37-1 is the registry number for 3-(5,6-Dimethyl-1h-benzimidazol-1-yl)-n'-hydroxypropanimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxypropanimidamide (CAS 887202-37-1) is a chemical compound with the molecular formula C12H16N4O and a molecular weight of 232.28 g/mol. IUPAC name: 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxypropanimidamide. InChIKey: UCEFLFSRMNCRSL-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxypropanimidamide |
| InChIKey | UCEFLFSRMNCRSL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)CC/C(=N/O)/N |
Computed by PubChem (NCBI)