CAS 726198-95-4 is the registry number for 2-(4,6-Dimethylpyrimidin-2-yl)-5-propyl-2,4-dihydro-3H-pyrazol-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,6-dimethylpyrimidin-2-yl)-5-propyl-4H-pyrazol-3-one (CAS 726198-95-4) is a chemical compound with the molecular formula C12H16N4O and a molecular weight of 232.28 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)-5-propyl-4H-pyrazol-3-one. InChIKey: PJYVZCQMJNAHEH-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)-5-propyl-4H-pyrazol-3-one |
| InChIKey | PJYVZCQMJNAHEH-UHFFFAOYSA-N |
| SMILES | CCCC1=NN(C(=O)C1)C2=NC(=CC(=N2)C)C |
Computed by PubChem (NCBI)