CAS 1009843-43-9 appears in our catalog under these names: Benzbromarone Impurity 13, Benzbromarone Impurity 14, 1-(2-Benzofuranyl)ethanone Hydrazone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(E)-1-(1-benzofuran-2-yl)ethylidenehydrazine (CAS 1009843-43-9) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (E)-1-(1-benzofuran-2-yl)ethylidenehydrazine. InChIKey: NMFDJZLPHFZNJI-KPKJPENVSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (E)-1-(1-benzofuran-2-yl)ethylidenehydrazine |
| InChIKey | NMFDJZLPHFZNJI-KPKJPENVSA-N |
| SMILES | C/C(=N\N)/C1=CC2=CC=CC=C2O1 |
Computed by PubChem (NCBI)