Products 100992-60-7
CAS 100992-60-7 is the registry number for Epibestatin (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid;hydrochloride (CAS 100992-60-7) is a chemical compound with the molecular formula C16H25ClN2O4 and a molecular weight of 344.8 g/mol. IUPAC name: (2S)-2-[[(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid;hydrochloride. InChIKey: XGDFITZJGKUSDK-FPFZOWOXSA-N.
| Molecular formula | C16H25ClN2O4 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | (2S)-2-[[(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid;hydrochloride |
| InChIKey | XGDFITZJGKUSDK-FPFZOWOXSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H]([C@@H](CC1=CC=CC=C1)N)O.Cl |
Computed by PubChem (NCBI)