CAS 2044702-45-4 is the registry number for Benzyl (S)–2–amino–4–((tert–butoxycarbonyl)amino)butanoate hydrochloride. Offered by: GLPBio. Available pack sizes: 1g.
Benzyl (2S)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride (CAS 2044702-45-4) is a chemical compound with the molecular formula C16H25ClN2O4 and a molecular weight of 344.8 g/mol. IUPAC name: benzyl (2S)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride. InChIKey: LXUBPLRBFFOHOR-ZOWNYOTGSA-N.
| Molecular formula | C16H25ClN2O4 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | benzyl (2S)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride |
| InChIKey | LXUBPLRBFFOHOR-ZOWNYOTGSA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)