Products 1010101-08-2
CAS 1010101-08-2 is the registry number for 2,6-Dichloro-3-methylpyridine-4-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,6-dichloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1010101-08-2) is a chemical compound with the molecular formula C12H16BCl2NO2 and a molecular weight of 288.0 g/mol. IUPAC name: 2,6-dichloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: DKKHFBMUYZBBJF-UHFFFAOYSA-N.
| Molecular formula | C12H16BCl2NO2 |
|---|---|
| Molecular weight | 288.0 g/mol |
| IUPAC name | 2,6-dichloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | DKKHFBMUYZBBJF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2C)Cl)Cl |
Computed by PubChem (NCBI)