CAS 1392845-46-3 is the registry number for 3,5-Dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1392845-46-3) is a chemical compound with the molecular formula C12H16BCl2NO2 and a molecular weight of 288.0 g/mol. IUPAC name: 3,5-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: KSBVFONMWDATON-UHFFFAOYSA-N.
| Molecular formula | C12H16BCl2NO2 |
|---|---|
| Molecular weight | 288.0 g/mol |
| IUPAC name | 3,5-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | KSBVFONMWDATON-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2Cl)N)Cl |
Computed by PubChem (NCBI)