CAS 2377608-68-7 appears in our catalog under these names: 2,3-Dichloro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%, 2,3-Dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
2,3-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2377608-68-7) is a chemical compound with the molecular formula C12H16BCl2NO2 and a molecular weight of 288.0 g/mol. IUPAC name: 2,3-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: UBYOIGMLUOXOTL-UHFFFAOYSA-N.
| Molecular formula | C12H16BCl2NO2 |
|---|---|
| Molecular weight | 288.0 g/mol |
| IUPAC name | 2,3-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | UBYOIGMLUOXOTL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)N)Cl)Cl |
Computed by PubChem (NCBI)