CAS 101012-31-1 appears in our catalog under these names: 2-Amino-3-chloro-5-iodobenzoic acid, 95%, 2-Amino-3-chloro-5-iodobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
2-amino-3-chloro-5-iodobenzoic acid (CAS 101012-31-1) is a chemical compound with the molecular formula C7H5ClINO2 and a molecular weight of 297.48 g/mol. IUPAC name: 2-amino-3-chloro-5-iodobenzoic acid. InChIKey: DZCKORLNNQYXLL-UHFFFAOYSA-N.
| Molecular formula | C7H5ClINO2 |
|---|---|
| Molecular weight | 297.48 g/mol |
| IUPAC name | 2-amino-3-chloro-5-iodobenzoic acid |
| InChIKey | DZCKORLNNQYXLL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)Cl)I |
Computed by PubChem (NCBI)