CAS 859794-01-7 is the registry number for 2-Chloro-4-iodo-5-nitrotoluene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
1-chloro-5-iodo-2-methyl-4-nitrobenzene (CAS 859794-01-7) is a chemical compound with the molecular formula C7H5ClINO2 and a molecular weight of 297.48 g/mol. IUPAC name: 1-chloro-5-iodo-2-methyl-4-nitrobenzene. InChIKey: GCXGZOXGUGMUGM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClINO2 |
|---|---|
| Molecular weight | 297.48 g/mol |
| IUPAC name | 1-chloro-5-iodo-2-methyl-4-nitrobenzene |
| InChIKey | GCXGZOXGUGMUGM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)