CAS 540501-04-0 appears in our catalog under these names: 2-Amino-4-chloro-5-iodo-benzoic acid, 95%, 2-Amino-4-chloro-5-iodobenzoic acid, 97%, 2-Amino-4-chloro-5-iodobenzoic acid, 2-Amino-4-chloro-5-iodobenzoic acid 95%, 2-Amino-4-chloro-5-iodo-benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100mg, 250mg.
2-amino-4-chloro-5-iodobenzoic acid (CAS 540501-04-0) is a chemical compound with the molecular formula C7H5ClINO2 and a molecular weight of 297.48 g/mol. IUPAC name: 2-amino-4-chloro-5-iodobenzoic acid. InChIKey: VOCXXKZBKWSNCR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClINO2 |
|---|---|
| Molecular weight | 297.48 g/mol |
| IUPAC name | 2-amino-4-chloro-5-iodobenzoic acid |
| InChIKey | VOCXXKZBKWSNCR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)Cl)N)C(=O)O |
Computed by PubChem (NCBI)