CAS 1010401-03-2 appears in our catalog under these names: 4-Amino-N-(dimethyl(oxo)-lambda6-sulfanylidene)benzamide, 98%, 4-​Amino-​N-​(dimethyloxido-​λ4-​sulfanylidene)​-benzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
4-amino-N-[dimethyl(oxo)-lambda6-sulfanylidene]benzamide (CAS 1010401-03-2) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 4-amino-N-[dimethyl(oxo)-lambda6-sulfanylidene]benzamide. InChIKey: GMQVGJACPAYBFB-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 4-amino-N-[dimethyl(oxo)-lambda6-sulfanylidene]benzamide |
| InChIKey | GMQVGJACPAYBFB-UHFFFAOYSA-N |
| SMILES | CS(=NC(=O)C1=CC=C(C=C1)N)(=O)C |
Computed by PubChem (NCBI)