CAS 1010811-75-2 appears in our catalog under these names: (1R,2R)-2-(Benzyloxy)cyclohexanamine hydrochloride, 95%, (1R,2R)-2-(Benzyloxy)cyclohexanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Trans-(1R,2R)-2-phenylmethoxycyclohexan-1-amine;hydrochloride (CAS 1010811-75-2) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: trans-(1R,2R)-2-phenylmethoxycyclohexan-1-amine;hydrochloride. InChIKey: ODDBKOFUCJGDJN-OJERSXHUSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | trans-(1R,2R)-2-phenylmethoxycyclohexan-1-amine;hydrochloride |
| InChIKey | ODDBKOFUCJGDJN-OJERSXHUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)