CAS 1010836-38-0 appears in our catalog under these names: 5-Bromo-n,n-diethyl-2-fluoronicotinamide, 95%, 5-Bromo-N,N-diethyl-2-fluoronicotinamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-bromo-N,N-diethyl-2-fluoropyridine-3-carboxamide (CAS 1010836-38-0) is a chemical compound with the molecular formula C10H12BrFN2O and a molecular weight of 275.12 g/mol. IUPAC name: 5-bromo-N,N-diethyl-2-fluoropyridine-3-carboxamide. InChIKey: NSXUQPBBZFVLNM-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFN2O |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 5-bromo-N,N-diethyl-2-fluoropyridine-3-carboxamide |
| InChIKey | NSXUQPBBZFVLNM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(N=CC(=C1)Br)F |
Computed by PubChem (NCBI)