Products 2273348-18-6
CAS 2273348-18-6 is the registry number for 5-bromo-N-(tert-butyl)-2-fluoronicotinamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-N-tert-butyl-2-fluoropyridine-3-carboxamide (CAS 2273348-18-6) is a chemical compound with the molecular formula C10H12BrFN2O and a molecular weight of 275.12 g/mol. IUPAC name: 5-bromo-N-tert-butyl-2-fluoropyridine-3-carboxamide. InChIKey: DVFOELCMTOWZNK-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFN2O |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 5-bromo-N-tert-butyl-2-fluoropyridine-3-carboxamide |
| InChIKey | DVFOELCMTOWZNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=C(N=CC(=C1)Br)F |
Computed by PubChem (NCBI)