Products 1340052-60-9
CAS 1340052-60-9 is the registry number for 2-((5-Bromo-2-fluorophenyl)amino)butanamide. Offered by: TRC. Available pack sizes: 100mg.
2-(5-bromo-2-fluoroanilino)butanamide (CAS 1340052-60-9) is a chemical compound with the molecular formula C10H12BrFN2O and a molecular weight of 275.12 g/mol. IUPAC name: 2-(5-bromo-2-fluoroanilino)butanamide. InChIKey: NHCDAVHGCBPGBR-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFN2O |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 2-(5-bromo-2-fluoroanilino)butanamide |
| InChIKey | NHCDAVHGCBPGBR-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)N)NC1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)