CAS 1010915-67-9 is the registry number for 2–(1H–Tetrazol–1–yl)terephthalic acid. Offered by: GLPBio. Available pack sizes: 1g, 500mg, 5g.
2-(tetrazol-1-yl)terephthalic acid (CAS 1010915-67-9) is a chemical compound with the molecular formula C9H6N4O4 and a molecular weight of 234.17 g/mol. IUPAC name: 2-(tetrazol-1-yl)terephthalic acid. InChIKey: NCIYPDVJXCHPCG-UHFFFAOYSA-N.
| Molecular formula | C9H6N4O4 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-(tetrazol-1-yl)terephthalic acid |
| InChIKey | NCIYPDVJXCHPCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N2C=NN=N2)C(=O)O |
Computed by PubChem (NCBI)