Products 1010915-67-9

CAS 1010915-67-9 is the registry number for 2–(1H–Tetrazol–1–yl)terephthalic acid. Offered by: GLPBio. Available pack sizes: 1g, 500mg, 5g.

Structural formula: {0} (CAS {1})

2-(tetrazol-1-yl)terephthalic acid (CAS 1010915-67-9) is a chemical compound with the molecular formula C9H6N4O4 and a molecular weight of 234.17 g/mol. IUPAC name: 2-(tetrazol-1-yl)terephthalic acid. InChIKey: NCIYPDVJXCHPCG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N4O4
Molecular weight234.17 g/mol
IUPAC name2-(tetrazol-1-yl)terephthalic acid
InChIKeyNCIYPDVJXCHPCG-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)N2C=NN=N2)C(=O)O

Computed by PubChem (NCBI)