Products 2438230-91-0
CAS 2438230-91-0 is the registry number for 2-(2H-Tetrazol-5-yl)terephthalicacid, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2H-tetrazol-5-yl)terephthalic acid (CAS 2438230-91-0) is a chemical compound with the molecular formula C9H6N4O4 and a molecular weight of 234.17 g/mol. IUPAC name: 2-(2H-tetrazol-5-yl)terephthalic acid. InChIKey: NDMYDKCXHQNKOL-UHFFFAOYSA-N.
| Molecular formula | C9H6N4O4 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-(2H-tetrazol-5-yl)terephthalic acid |
| InChIKey | NDMYDKCXHQNKOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C2=NNN=N2)C(=O)O |
Computed by PubChem (NCBI)