CAS 944905-90-2 appears in our catalog under these names: 1-(3-Nitrophenyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 1-(3-Nitrophenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-(3-nitrophenyl)triazole-4-carboxylic acid (CAS 944905-90-2) is a chemical compound with the molecular formula C9H6N4O4 and a molecular weight of 234.17 g/mol. IUPAC name: 1-(3-nitrophenyl)triazole-4-carboxylic acid. InChIKey: YHUTUVUHTBFLBF-UHFFFAOYSA-N.
| Molecular formula | C9H6N4O4 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 1-(3-nitrophenyl)triazole-4-carboxylic acid |
| InChIKey | YHUTUVUHTBFLBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)