CAS 1010928-60-5 is the registry number for 3-{5,11-Dioxo-5H,6H,6aH,11H-isoindolo(2,1-a)quinazolin-6-yl}propanoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)propanoic acid (CAS 1010928-60-5) is a chemical compound with the molecular formula C18H14N2O4 and a molecular weight of 322.3 g/mol. IUPAC name: 3-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)propanoic acid. InChIKey: KAWOUENTKWFZLX-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O4 |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | 3-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)propanoic acid |
| InChIKey | KAWOUENTKWFZLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3N(C(=O)C4=CC=CC=C4N3C2=O)CCC(=O)O |
Computed by PubChem (NCBI)