CAS 304448-55-3 appears in our catalog under these names: N'-(3,4-Dihydroxybenzylidene)-3-hydroxy-2-naphthohydrazide, 98%, Dynamin Inhibitor I, Dynasore, >95% (HPLC), Dynasore/ 99.89% (existing batch purity), Dynasore, Dynasore hydrate, 98.00%. Offered by: Fluorochem, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 10mg, 50mg, 250mg, 25mg, 5mg, 100mg, 200mg, 500mg.
N-[(3,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide (CAS 304448-55-3) is a chemical compound with the molecular formula C18H14N2O4 and a molecular weight of 322.3 g/mol. IUPAC name: N-[(3,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide. InChIKey: SYNDQCRDGGCQRZ-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O4 |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | N-[(3,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| InChIKey | SYNDQCRDGGCQRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NN=CC3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)