Products 351001-15-5
CAS 351001-15-5 is the registry number for 2-[4-(Carbamoylmethoxy)phenyl]quinoline-4-carboxylic acid. Offered by: Fluorochem. Available pack sizes: 1g.
2-[4-(2-amino-2-oxoethoxy)phenyl]quinoline-4-carboxylic acid (CAS 351001-15-5) is a chemical compound with the molecular formula C18H14N2O4 and a molecular weight of 322.3 g/mol. IUPAC name: 2-[4-(2-amino-2-oxoethoxy)phenyl]quinoline-4-carboxylic acid. InChIKey: POUNLCVQYLKRON-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O4 |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | 2-[4-(2-amino-2-oxoethoxy)phenyl]quinoline-4-carboxylic acid |
| InChIKey | POUNLCVQYLKRON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)OCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)