CAS 1010929-95-9 is the registry number for N-(2-Aminoethyl)-2,1,3-benzoxadiazole-4-sulfonamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
N-(2-aminoethyl)-2,1,3-benzoxadiazole-4-sulfonamide (CAS 1010929-95-9) is a chemical compound with the molecular formula C8H10N4O3S and a molecular weight of 242.26 g/mol. IUPAC name: N-(2-aminoethyl)-2,1,3-benzoxadiazole-4-sulfonamide. InChIKey: YPBFBTXFVPBLSO-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O3S |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | N-(2-aminoethyl)-2,1,3-benzoxadiazole-4-sulfonamide |
| InChIKey | YPBFBTXFVPBLSO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NON=C2C(=C1)S(=O)(=O)NCCN |
Computed by PubChem (NCBI)