CAS 1011134-93-2 is the registry number for N-Allyl-3-bromo-2,5-dimethoxybenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2,5-dimethoxy-N-prop-2-enylbenzamide (CAS 1011134-93-2) is a chemical compound with the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. IUPAC name: 3-bromo-2,5-dimethoxy-N-prop-2-enylbenzamide. InChIKey: IGRAZFCZDJLYJG-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO3 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 3-bromo-2,5-dimethoxy-N-prop-2-enylbenzamide |
| InChIKey | IGRAZFCZDJLYJG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)OC)C(=O)NCC=C |
Computed by PubChem (NCBI)