CAS 1011203-19-2 is the registry number for 2-Hydroxy-N-(2-(thiophen-2-yl)ethyl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-N-(2-thiophen-2-ylethyl)benzamide (CAS 1011203-19-2) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: 2-hydroxy-N-(2-thiophen-2-ylethyl)benzamide. InChIKey: LJCGBHHWGYNISY-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | 2-hydroxy-N-(2-thiophen-2-ylethyl)benzamide |
| InChIKey | LJCGBHHWGYNISY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCC2=CC=CS2)O |
Computed by PubChem (NCBI)