Products 1011398-17-6
CAS 1011398-17-6 is the registry number for 3-(4-Chlorophenyl)-2H-1,2,6-thiadiazine 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(4-chlorophenyl)-2H-1,2,6-thiadiazine 1,1-dioxide (CAS 1011398-17-6) is a chemical compound with the molecular formula C9H7ClN2O2S and a molecular weight of 242.68 g/mol. IUPAC name: 3-(4-chlorophenyl)-2H-1,2,6-thiadiazine 1,1-dioxide. InChIKey: ZFTFSIFSNPVQLO-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2S |
|---|---|
| Molecular weight | 242.68 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2H-1,2,6-thiadiazine 1,1-dioxide |
| InChIKey | ZFTFSIFSNPVQLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NS(=O)(=O)N2)Cl |
Computed by PubChem (NCBI)