Products 1011398-75-6
CAS 1011398-75-6 is the registry number for 4-(4-(Methoxycarbonyl)-3-methyl-6-phenyl-1H-pyrazolo(3,4-b)pyridin-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(4-methoxycarbonyl-3-methyl-6-phenylpyrazolo[5,4-b]pyridin-1-yl)benzoic acid (CAS 1011398-75-6) is a chemical compound with the molecular formula C22H17N3O4 and a molecular weight of 387.4 g/mol. IUPAC name: 4-(4-methoxycarbonyl-3-methyl-6-phenylpyrazolo[5,4-b]pyridin-1-yl)benzoic acid. InChIKey: NWOLREUHAIPJIH-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 4-(4-methoxycarbonyl-3-methyl-6-phenylpyrazolo[5,4-b]pyridin-1-yl)benzoic acid |
| InChIKey | NWOLREUHAIPJIH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3=CC=CC=C3)C(=O)OC)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)