Products 1266741-05-2
CAS 1266741-05-2 appears in our catalog under these names: Deferasirox Methyl Ester, Deferasirox Impurity 11, Deferasirox Impurity 7, Deferasirox Methyl Ester, >95% (HPLC), Deferasirox methyl ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Ambeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
Methyl 4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzoate (CAS 1266741-05-2) is a chemical compound with the molecular formula C22H17N3O4 and a molecular weight of 387.4 g/mol. IUPAC name: methyl 4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzoate. InChIKey: SQUCUUVFSUCLCC-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | methyl 4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzoate |
| InChIKey | SQUCUUVFSUCLCC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N2C(=NC(=N2)C3=CC=CC=C3O)C4=CC=CC=C4O |
Computed by PubChem (NCBI)