CAS 2375424-89-6 is the registry number for IGF-1R modulator 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(3-methyl-4-phenoxyphenyl)-3-phenyl-1,3,5-triazinane-2,4,6-trione (CAS 2375424-89-6) is a chemical compound with the molecular formula C22H17N3O4 and a molecular weight of 387.4 g/mol. IUPAC name: 1-(3-methyl-4-phenoxyphenyl)-3-phenyl-1,3,5-triazinane-2,4,6-trione. InChIKey: REYFGVMCUDWCML-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 1-(3-methyl-4-phenoxyphenyl)-3-phenyl-1,3,5-triazinane-2,4,6-trione |
| InChIKey | REYFGVMCUDWCML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=O)NC(=O)N(C2=O)C3=CC=CC=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)