CAS 101143-87-7 is the registry number for Ep vinyl quinidine. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(S)-[(2R,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (CAS 101143-87-7) is a chemical compound with the molecular formula C20H24N2O2 and a molecular weight of 324.4 g/mol. IUPAC name: (S)-[(2R,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol. InChIKey: LOUPRKONTZGTKE-ITHTXLDVSA-N.
| Molecular formula | C20H24N2O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (S)-[(2R,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| InChIKey | LOUPRKONTZGTKE-ITHTXLDVSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@@H]([C@H]3C[C@@H]4CCN3C[C@H]4C=C)O |
Computed by PubChem (NCBI)