Products 1012-17-5
CAS 1012-17-5 appears in our catalog under these names: 2-(4-Chlorobenzyl)propanoic Acid, Benzenepropanoic acid, 4-chloro-a-methyl-, 98%, 3-(4-Chloro-phenyl)-2-methyl-propionic acid. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 500mg, 5g, 250mg, 2,5g.
3-(4-chlorophenyl)-2-methylpropanoic acid (CAS 1012-17-5) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 3-(4-chlorophenyl)-2-methylpropanoic acid. InChIKey: DFLJNMPGPGFGBR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2-methylpropanoic acid |
| InChIKey | DFLJNMPGPGFGBR-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(4-chlorophenyl)-2-methylpropanoic acid, 3-(4-Chloro-phenyl)-2-methyl-propionic acid, 2-(4-Chlorobenzyl)propanoic acid, 3-(4-chlorophenyl)-2-methylpropionic acid, 2-methyl-3-(4-chlorophenyl)propionic acid, DFLJNMPGPGFGBR-UHFFFAOYSA-N, Benzenepropanoicacid,4-chloro-a-methyl-, Benzenepropanoic acid, 4-chloro-a-methyl-, 2-methyl-3-(4-chlorophenyl) propionic acid, 3-(4-chlorophenyl)-2-methyl-propanoic acid