Products 199679-74-8
CAS 199679-74-8 is the registry number for (R)-3-(4-Chlorophenyl)-2-methylpropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3-(4-chlorophenyl)-2-methylpropanoic acid (CAS 199679-74-8) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: (2R)-3-(4-chlorophenyl)-2-methylpropanoic acid. InChIKey: DFLJNMPGPGFGBR-SSDOTTSWSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | (2R)-3-(4-chlorophenyl)-2-methylpropanoic acid |
| InChIKey | DFLJNMPGPGFGBR-SSDOTTSWSA-N |
| SMILES | C[C@H](CC1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)