Products 101205-27-0
CAS 101205-27-0 is the registry number for 1-[1-[(tert-Butyldimethylsilyl)oxy]cyclopropyl]ethanone, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[1-[tert-butyl(dimethyl)silyl]oxycyclopropyl]ethanone (CAS 101205-27-0) is a chemical compound with the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. IUPAC name: 1-[1-[tert-butyl(dimethyl)silyl]oxycyclopropyl]ethanone. InChIKey: KQJNNHRQYKIYPZ-UHFFFAOYSA-N.
| Molecular formula | C11H22O2Si |
|---|---|
| Molecular weight | 214.38 g/mol |
| IUPAC name | 1-[1-[tert-butyl(dimethyl)silyl]oxycyclopropyl]ethanone |
| InChIKey | KQJNNHRQYKIYPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(CC1)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)