CAS 81939-24-4 is the registry number for rel-(1R,4S)-4-((tert-Butyldimethylsilyl)oxy)cyclopent-2-en-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol (CAS 81939-24-4) is a chemical compound with the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. IUPAC name: (1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol. InChIKey: VRSPJPYUHXNQHT-VHSXEESVSA-N.
| Molecular formula | C11H22O2Si |
|---|---|
| Molecular weight | 214.38 g/mol |
| IUPAC name | (1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol |
| InChIKey | VRSPJPYUHXNQHT-VHSXEESVSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](C=C1)O |
Computed by PubChem (NCBI)