CAS 130650-09-8 appears in our catalog under these names: 3,4-Dihydro-6-[(tert-butyl)dimethyl silyloxy]-2h-pyran, 95%, tert-Butyl((3,4-dihydro-2H-pyran-6-yl)oxy)dimethylsilane, 97+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl-(3,4-dihydro-2H-pyran-6-yloxy)-dimethylsilane (CAS 130650-09-8) is a chemical compound with the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. IUPAC name: tert-butyl-(3,4-dihydro-2H-pyran-6-yloxy)-dimethylsilane. InChIKey: RBKFRODDAPGVLP-UHFFFAOYSA-N.
| Molecular formula | C11H22O2Si |
|---|---|
| Molecular weight | 214.38 g/mol |
| IUPAC name | tert-butyl-(3,4-dihydro-2H-pyran-6-yloxy)-dimethylsilane |
| InChIKey | RBKFRODDAPGVLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CCCCO1 |
Computed by PubChem (NCBI)