CAS 1426426-45-0 is the registry number for Rel-(1s,3s)-3-((tert-butyldimethylsilyl)oxy)cyclobutane-1-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[tert-butyl(dimethyl)silyl]oxycyclobutane-1-carbaldehyde (CAS 1426426-45-0) is a chemical compound with the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxycyclobutane-1-carbaldehyde. InChIKey: CEDGVCLIZGXGLW-UHFFFAOYSA-N.
| Molecular formula | C11H22O2Si |
|---|---|
| Molecular weight | 214.38 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxycyclobutane-1-carbaldehyde |
| InChIKey | CEDGVCLIZGXGLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C1)C=O |
Computed by PubChem (NCBI)