CAS 10130-89-9 appears in our catalog under these names: 4-(Chlorosulfonyl)benzoic acid, 97%, (Chlorosulfonyl)benzoic Acid, 4–(Chlorosulfonyl)benzoic acid, 4-(Chlorosulfonyl)benzoic acid, 96% , 4-(Chlorosulfonyl)benzoic acid. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 2,5g, 2g, 500g.
4-chlorosulfonylbenzoic acid (CAS 10130-89-9) is a chemical compound with the molecular formula C7H5ClO4S and a molecular weight of 220.63 g/mol. IUPAC name: 4-chlorosulfonylbenzoic acid. InChIKey: PTCSSXYPZOFISK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO4S |
|---|---|
| Molecular weight | 220.63 g/mol |
| IUPAC name | 4-chlorosulfonylbenzoic acid |
| InChIKey | PTCSSXYPZOFISK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)