CAS 4025-64-3 appears in our catalog under these names: 3–(Chlorosulfonyl)benzoic acid, 3-(Chlorosulfonyl)benzoic acid, 3-(Chlorosulfonyl)benzoic acid, 96% , 3-(Chlorosulfonyl)benzoic acid 96%, 3-(CHLOROSULFONYL)BENZOIC ACID, 95%. Offered by: GLPBio, Biosynth, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 1kg, 0,5kg, 2kg, 5g, 10g, 500g.
3-chlorosulfonylbenzoic acid (CAS 4025-64-3) is a chemical compound with the molecular formula C7H5ClO4S and a molecular weight of 220.63 g/mol. IUPAC name: 3-chlorosulfonylbenzoic acid. InChIKey: LMRKXSDOAFUINK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO4S |
|---|---|
| Molecular weight | 220.63 g/mol |
| IUPAC name | 3-chlorosulfonylbenzoic acid |
| InChIKey | LMRKXSDOAFUINK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)