CAS 1013025-04-1 appears in our catalog under these names: Ezetimibe Impurity 117, Ezetimibe Diacid Impurity. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(2R)-2-[(S)-(4-fluoroanilino)-(4-phenylmethoxyphenyl)methyl]pentanedioic acid (CAS 1013025-04-1) is a chemical compound with the molecular formula C25H24FNO5 and a molecular weight of 437.5 g/mol. IUPAC name: (2R)-2-[(S)-(4-fluoroanilino)-(4-phenylmethoxyphenyl)methyl]pentanedioic acid. InChIKey: WLAMIMDXLOJKMS-ISKFKSNPSA-N.
| Molecular formula | C25H24FNO5 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (2R)-2-[(S)-(4-fluoroanilino)-(4-phenylmethoxyphenyl)methyl]pentanedioic acid |
| InChIKey | WLAMIMDXLOJKMS-ISKFKSNPSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)[C@H]([C@@H](CCC(=O)O)C(=O)O)NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)