CAS 1611499-16-1 appears in our catalog under these names: Pitavastatin Impurity 41, Pitavastatin Impurity 8, Pitavastatin N-oxide, Pitavastatin Impurity 44. Offered by: Chemat Brand, Biosynth, Hubei YoungXin. Available pack sizes: on request, 2mg, 1mg, 5mg, 25mg, 10mg, 50mg, 100mg.
(E,3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-1-oxidoquinolin-1-ium-3-yl]-3,5-dihydroxyhept-6-enoic acid (CAS 1611499-16-1) is a chemical compound with the molecular formula C25H24FNO5 and a molecular weight of 437.5 g/mol. IUPAC name: (E,3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-1-oxidoquinolin-1-ium-3-yl]-3,5-dihydroxyhept-6-enoic acid. InChIKey: RFPVNKKYYZMXMQ-MCBHFWOFSA-N.
| Molecular formula | C25H24FNO5 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (E,3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-1-oxidoquinolin-1-ium-3-yl]-3,5-dihydroxyhept-6-enoic acid |
| InChIKey | RFPVNKKYYZMXMQ-MCBHFWOFSA-N |
| SMILES | C1CC1C2=[N+](C3=CC=CC=C3C(=C2/C=C/[C@H](C[C@H](CC(=O)O)O)O)C4=CC=C(C=C4)F)[O-] |
Computed by PubChem (NCBI)