CAS 224320-09-6 appears in our catalog under these names: Pitavastatin Impurity 67, 8-Hydroxy Pitavastatin. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(E,3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-8-hydroxyquinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid (CAS 224320-09-6) is a chemical compound with the molecular formula C25H24FNO5 and a molecular weight of 437.5 g/mol. IUPAC name: (E,3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-8-hydroxyquinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid. InChIKey: XWHCMMKZXJAJMB-NDZBKKTDSA-N.
| Molecular formula | C25H24FNO5 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (E,3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-8-hydroxyquinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid |
| InChIKey | XWHCMMKZXJAJMB-NDZBKKTDSA-N |
| SMILES | C1CC1C2=C(C(=C3C=CC=C(C3=N2)O)C4=CC=C(C=C4)F)/C=C/[C@H](C[C@H](CC(=O)O)O)O |
Computed by PubChem (NCBI)