CAS 101327-84-8 appears in our catalog under these names: 1-Nitro-2-naphthaldehyde, 98%, 1-Nitro-2-naphthaldehyde 97%, 1-NITRO-2-NAPHTHALDEHYDE, 97%, 1-Nitro-2-naphthaldehyde, 97%, 97%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
1-nitronaphthalene-2-carbaldehyde (CAS 101327-84-8) is a chemical compound with the molecular formula C11H7NO3 and a molecular weight of 201.18 g/mol. IUPAC name: 1-nitronaphthalene-2-carbaldehyde. InChIKey: XQIMHJNMEFIADP-UHFFFAOYSA-N.
| Molecular formula | C11H7NO3 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 1-nitronaphthalene-2-carbaldehyde |
| InChIKey | XQIMHJNMEFIADP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)