CAS 855401-44-4 appears in our catalog under these names: 1H,3H,4H-(1,4)Oxazino(4,3-a)indole-1,3-dione, 95%, 1H,3H,4H-(1,4)Oxazino(4,3-a)indole-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4H-[1,4]oxazino[4,3-a]indole-1,3-dione (CAS 855401-44-4) is a chemical compound with the molecular formula C11H7NO3 and a molecular weight of 201.18 g/mol. IUPAC name: 4H-[1,4]oxazino[4,3-a]indole-1,3-dione. InChIKey: QBBPNPLZOCHBSW-UHFFFAOYSA-N.
| Molecular formula | C11H7NO3 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 4H-[1,4]oxazino[4,3-a]indole-1,3-dione |
| InChIKey | QBBPNPLZOCHBSW-UHFFFAOYSA-N |
| SMILES | C1C(=O)OC(=O)C2=CC3=CC=CC=C3N21 |
Computed by PubChem (NCBI)